C14H20O4 — CID 154713959
(3S,4aS,8aR)-3-cyclohexyl-8a-methyl-4a,5-dihydro-1,2,4-benzotrioxin-6-one (PubChem CID 154713959) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (3S,4aS,8aR)-3-cyclohexyl-8a-methyl-4a,5-dihydro-1,2,4-benzotrioxin-6-one.
| Compound Name | (3S,4aS,8aR)-3-cyclohexyl-8a-methyl-4a,5-dihydro-1,2,4-benzotrioxin-6-one |
|---|---|
| PubChem CID | 154713959 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (3S,4aS,8aR)-3-cyclohexyl-8a-methyl-4a,5-dihydro-1,2,4-benzotrioxin-6-one |
| SMILES | C[C@@]12C=CC(=O)C[C@@H]1O[C@H](C1CCCCC1)OO2 |
| InChI | InChI=1S/C14H20O4/c1-14-8-7-11(15)9-12(14)16-13(17-18-14)10-5-3-2-4-6-10/h7-8,10,12-13H,2-6,9H2,1H3/t12-,13-,14+/m0/s1 |
| InChIKey | HNYCHLFZGVFGEI-MELADBBJSA-N |
| XLogP | 2.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|