C13H20O5 — CID 154714616
(3S,4aS,8aR)-8a-(2-methoxyethyl)-3-propan-2-yl-4a,5-dihydro-1,2,4-benzotrioxin-6-one (PubChem CID 154714616) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (3S,4aS,8aR)-8a-(2-methoxyethyl)-3-propan-2-yl-4a,5-dihydro-1,2,4-benzotrioxin-6-one.
| Compound Name | (3S,4aS,8aR)-8a-(2-methoxyethyl)-3-propan-2-yl-4a,5-dihydro-1,2,4-benzotrioxin-6-one |
|---|---|
| PubChem CID | 154714616 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (3S,4aS,8aR)-8a-(2-methoxyethyl)-3-propan-2-yl-4a,5-dihydro-1,2,4-benzotrioxin-6-one |
| SMILES | COCC[C@@]12C=CC(=O)C[C@@H]1O[C@H](C(C)C)OO2 |
| InChI | InChI=1S/C13H20O5/c1-9(2)12-16-11-8-10(14)4-5-13(11,18-17-12)6-7-15-3/h4-5,9,11-12H,6-8H2,1-3H3/t11-,12-,13-/m0/s1 |
| InChIKey | VLGVNCQUCRXZAR-AVGNSLFASA-N |
| XLogP | 1.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|