C13H20O4 — CID 71507361
(4aR,8aR)-4a-tert-butylperoxy-3,4,8,8a-tetrahydro-2H-chromen-7-one (PubChem CID 71507361) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (4aR,8aR)-4a-tert-butylperoxy-3,4,8,8a-tetrahydro-2H-chromen-7-one.
| Compound Name | (4aR,8aR)-4a-tert-butylperoxy-3,4,8,8a-tetrahydro-2H-chromen-7-one |
|---|---|
| PubChem CID | 71507361 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (4aR,8aR)-4a-tert-butylperoxy-3,4,8,8a-tetrahydro-2H-chromen-7-one |
| SMILES | CC(C)(C)OO[C@]12C=CC(=O)C[C@H]1OCCC2 |
| InChI | InChI=1S/C13H20O4/c1-12(2,3)16-17-13-6-4-8-15-11(13)9-10(14)5-7-13/h5,7,11H,4,6,8-9H2,1-3H3/t11-,13-/m1/s1 |
| InChIKey | LUHRJTUSYOIJBY-DGCLKSJQSA-N |
| XLogP | 2.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|