C9H12O3 — CID 130036378
4a-hydroxy-3,4,8,8a-tetrahydro-2H-chromen-7-one (PubChem CID 130036378) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 4a-hydroxy-3,4,8,8a-tetrahydro-2H-chromen-7-one.
| Compound Name | 4a-hydroxy-3,4,8,8a-tetrahydro-2H-chromen-7-one |
|---|---|
| PubChem CID | 130036378 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 4a-hydroxy-3,4,8,8a-tetrahydro-2H-chromen-7-one |
| SMILES | O=C1C=CC2(O)CCCOC2C1 |
| InChI | InChI=1S/C9H12O3/c10-7-2-4-9(11)3-1-5-12-8(9)6-7/h2,4,8,11H,1,3,5-6H2 |
| InChIKey | MLPJPAXRCHEEOY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |