C27H27NO5 — CID 154713972
benzyl 6-oxo-2-phenyl-4-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 154713972) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is benzyl 6-oxo-2-phenyl-4-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | benzyl 6-oxo-2-phenyl-4-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 154713972 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | benzyl 6-oxo-2-phenyl-4-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | O=CCC(CC(C(=O)OCc1ccccc1)c1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H27NO5/c29-17-16-24(28-27(31)33-20-22-12-6-2-7-13-22)18-25(23-14-8-3-9-15-23)26(30)32-19-21-10-4-1-5-11-21/h1-15,17,24-25H,16,18-20H2,(H,28,31) |
| InChIKey | ADZUKNKXCLKMPQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|