C22H21FO2 — CID 154714175
(E)-3-[(1S,5R,6S)-6-(4-fluorophenyl)-2,2-dimethyl-3-oxabicyclo[3.1.0]hexan-1-yl]-1-phenylprop-2-en-1-one (PubChem CID 154714175) has the molecular formula C22H21FO2 and a molecular weight of 336.41 g/mol. Its IUPAC name is (E)-3-[(1S,5R,6S)-6-(4-fluorophenyl)-2,2-dimethyl-3-oxabicyclo[3.1.0]hexan-1-yl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[(1S,5R,6S)-6-(4-fluorophenyl)-2,2-dimethyl-3-oxabicyclo[3.1.0]hexan-1-yl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 154714175 |
| Molecular Formula | C22H21FO2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (E)-3-[(1S,5R,6S)-6-(4-fluorophenyl)-2,2-dimethyl-3-oxabicyclo[3.1.0]hexan-1-yl]-1-phenylprop-2-en-1-one |
| SMILES | CC1(C)OC[C@@H]2[C@@H](c3ccc(F)cc3)[C@@]21/C=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H21FO2/c1-21(2)22(13-12-19(24)15-6-4-3-5-7-15)18(14-25-21)20(22)16-8-10-17(23)11-9-16/h3-13,18,20H,14H2,1-2H3/b13-12+/t18-,20-,22-/m1/s1 |
| InChIKey | MWDGUXPSPBHSAD-MKUBILRDSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|