C19H18F2O3 — CID 162408126
3-(1,4-dioxan-2-yl)-1,2-bis(4-fluorophenyl)propan-1-one (PubChem CID 162408126) has the molecular formula C19H18F2O3 and a molecular weight of 332.35 g/mol. Its IUPAC name is 3-(1,4-dioxan-2-yl)-1,2-bis(4-fluorophenyl)propan-1-one.
| Compound Name | 3-(1,4-dioxan-2-yl)-1,2-bis(4-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 162408126 |
| Molecular Formula | C19H18F2O3 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-(1,4-dioxan-2-yl)-1,2-bis(4-fluorophenyl)propan-1-one |
| SMILES | O=C(c1ccc(F)cc1)C(CC1COCCO1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18F2O3/c20-15-5-1-13(2-6-15)18(11-17-12-23-9-10-24-17)19(22)14-3-7-16(21)8-4-14/h1-8,17-18H,9-12H2 |
| InChIKey | HXUKHGODJVERMZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |