C14H16F2O2 — CID 155929879
2,2-difluoro-1-(4-methylphenyl)-2-(oxan-4-yl)ethanone (PubChem CID 155929879) has the molecular formula C14H16F2O2 and a molecular weight of 254.28 g/mol. Its IUPAC name is 2,2-difluoro-1-(4-methylphenyl)-2-(oxan-4-yl)ethanone.
| Compound Name | 2,2-difluoro-1-(4-methylphenyl)-2-(oxan-4-yl)ethanone |
|---|---|
| PubChem CID | 155929879 |
| Molecular Formula | C14H16F2O2 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2,2-difluoro-1-(4-methylphenyl)-2-(oxan-4-yl)ethanone |
| SMILES | Cc1ccc(C(=O)C(F)(F)C2CCOCC2)cc1 |
| InChI | InChI=1S/C14H16F2O2/c1-10-2-4-11(5-3-10)13(17)14(15,16)12-6-8-18-9-7-12/h2-5,12H,6-9H2,1H3 |
| InChIKey | MSORXGXDLQMVTR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |