C37H42N4 — CID 15471420
5,5,10,10,15,15,20,20-octamethyl-2-[2-(4-methylphenyl)ethynyl]-21,22,23,24-tetrahydroporphyrin (PubChem CID 15471420) has the molecular formula C37H42N4 and a molecular weight of 542.77 g/mol. Its IUPAC name is 5,5,10,10,15,15,20,20-octamethyl-2-[2-(4-methylphenyl)ethynyl]-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,5,10,10,15,15,20,20-octamethyl-2-[2-(4-methylphenyl)ethynyl]-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 15471420 |
| Molecular Formula | C37H42N4 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | 5,5,10,10,15,15,20,20-octamethyl-2-[2-(4-methylphenyl)ethynyl]-21,22,23,24-tetrahydroporphyrin |
| SMILES | Cc1ccc(C#Cc2cc3[nH]c2C(C)(C)c2ccc([nH]2)C(C)(C)c2ccc([nH]2)C(C)(C)c2ccc([nH]2)C3(C)C)cc1 |
| InChI | InChI=1S/C37H42N4/c1-23-10-12-24(13-11-23)14-15-25-22-32-36(6,7)30-19-18-28(39-30)34(2,3)26-16-17-27(38-26)35(4,5)29-20-21-31(40-29)37(8,9)33(25)41-32/h10-13,16-22,38-41H,1-9H3 |
| InChIKey | CYPOXAFFATVJCO-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|