C15H16Cl2FNO — CID 154714277
(3aS,6S,6aR)-2-(3,5-dichlorophenyl)-6-(2-fluoropropan-2-yl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole (PubChem CID 154714277) has the molecular formula C15H16Cl2FNO and a molecular weight of 316.20 g/mol. Its IUPAC name is (3aS,6S,6aR)-2-(3,5-dichlorophenyl)-6-(2-fluoropropan-2-yl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole.
| Compound Name | (3aS,6S,6aR)-2-(3,5-dichlorophenyl)-6-(2-fluoropropan-2-yl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole |
|---|---|
| PubChem CID | 154714277 |
| Molecular Formula | C15H16Cl2FNO |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | (3aS,6S,6aR)-2-(3,5-dichlorophenyl)-6-(2-fluoropropan-2-yl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole |
| SMILES | CC(C)(F)[C@H]1CC[C@@H]2N=C(c3cc(Cl)cc(Cl)c3)O[C@@H]21 |
| InChI | InChI=1S/C15H16Cl2FNO/c1-15(2,18)11-3-4-12-13(11)20-14(19-12)8-5-9(16)7-10(17)6-8/h5-7,11-13H,3-4H2,1-2H3/t11-,12-,13+/m0/s1 |
| InChIKey | BXFMEYRLZYLTBV-RWMBFGLXSA-N |
| XLogP | 4.67 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |