C17H16FNO — CID 154714281
(5S)-5-fluoro-5-methyl-2,6-diphenyl-4,6-dihydro-1,3-oxazine (PubChem CID 154714281) has the molecular formula C17H16FNO and a molecular weight of 269.32 g/mol. Its IUPAC name is (5S)-5-fluoro-5-methyl-2,6-diphenyl-4,6-dihydro-1,3-oxazine.
| Compound Name | (5S)-5-fluoro-5-methyl-2,6-diphenyl-4,6-dihydro-1,3-oxazine |
|---|---|
| PubChem CID | 154714281 |
| Molecular Formula | C17H16FNO |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (5S)-5-fluoro-5-methyl-2,6-diphenyl-4,6-dihydro-1,3-oxazine |
| SMILES | C[C@]1(F)CN=C(c2ccccc2)OC1c1ccccc1 |
| InChI | InChI=1S/C17H16FNO/c1-17(18)12-19-16(14-10-6-3-7-11-14)20-15(17)13-8-4-2-5-9-13/h2-11,15H,12H2,1H3/t15?,17-/m0/s1 |
| InChIKey | NQDUXXWONJQGKC-LWKPJOBUSA-N |
| XLogP | 3.93 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |