C16H14FNO — CID 154714452
(5S)-5-fluoro-2,6-diphenyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 154714452) has the molecular formula C16H14FNO and a molecular weight of 255.29 g/mol. Its IUPAC name is (5S)-5-fluoro-2,6-diphenyl-5,6-dihydro-4H-1,3-oxazine.
| Compound Name | (5S)-5-fluoro-2,6-diphenyl-5,6-dihydro-4H-1,3-oxazine |
|---|---|
| PubChem CID | 154714452 |
| Molecular Formula | C16H14FNO |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (5S)-5-fluoro-2,6-diphenyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | F[C@H]1CN=C(c2ccccc2)OC1c1ccccc1 |
| InChI | InChI=1S/C16H14FNO/c17-14-11-18-16(13-9-5-2-6-10-13)19-15(14)12-7-3-1-4-8-12/h1-10,14-15H,11H2/t14-,15?/m0/s1 |
| InChIKey | RHVPFAAHDBVYBL-MLCCFXAWSA-N |
| XLogP | 3.54 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |