C18H26O6 — CID 154714823
3-phenyl-1-[(2S)-3,4,5,6-tetramethoxyoxan-2-yl]propan-1-one (PubChem CID 154714823) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is 3-phenyl-1-[(2S)-3,4,5,6-tetramethoxyoxan-2-yl]propan-1-one.
| Compound Name | 3-phenyl-1-[(2S)-3,4,5,6-tetramethoxyoxan-2-yl]propan-1-one |
|---|---|
| PubChem CID | 154714823 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-phenyl-1-[(2S)-3,4,5,6-tetramethoxyoxan-2-yl]propan-1-one |
| SMILES | COC1O[C@H](C(=O)CCc2ccccc2)C(OC)C(OC)C1OC |
| InChI | InChI=1S/C18H26O6/c1-20-15-14(13(19)11-10-12-8-6-5-7-9-12)24-18(23-4)17(22-3)16(15)21-2/h5-9,14-18H,10-11H2,1-4H3/t14-,15?,16?,17?,18?/m1/s1 |
| InChIKey | JZMIBNXKTQATGZ-CZVCLPBNSA-N |
| XLogP | 1.60 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |