C25H21NO2S — CID 154715131
3-benzyl-2-(4-methylphenyl)sulfonyl-4H-indeno[1,2-c]pyrrole (PubChem CID 154715131) has the molecular formula C25H21NO2S and a molecular weight of 399.52 g/mol. Its IUPAC name is 3-benzyl-2-(4-methylphenyl)sulfonyl-4H-indeno[1,2-c]pyrrole.
| Compound Name | 3-benzyl-2-(4-methylphenyl)sulfonyl-4H-indeno[1,2-c]pyrrole |
|---|---|
| PubChem CID | 154715131 |
| Molecular Formula | C25H21NO2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-benzyl-2-(4-methylphenyl)sulfonyl-4H-indeno[1,2-c]pyrrole |
| SMILES | Cc1ccc(S(=O)(=O)n2cc3c(c2Cc2ccccc2)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C25H21NO2S/c1-18-11-13-21(14-12-18)29(27,28)26-17-24-22-10-6-5-9-20(22)16-23(24)25(26)15-19-7-3-2-4-8-19/h2-14,17H,15-16H2,1H3 |
| InChIKey | WRWZIUHQFXOBNN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |