About 5-fluoro-2-hexyloxane
5-fluoro-2-hexyloxane (PubChem CID 154715253) has the molecular formula C11H21FO
and a molecular weight of 188.29 g/mol. Its IUPAC name is 5-fluoro-2-hexyloxane.
Molecular Properties
| Compound Name | 5-fluoro-2-hexyloxane |
| PubChem CID | 154715253 |
| Molecular Formula | C11H21FO |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 5-fluoro-2-hexyloxane |
| SMILES | CCCCCCC1CCC(F)CO1 |
| InChI | InChI=1S/C11H21FO/c1-2-3-4-5-6-11-8-7-10(12)9-13-11/h10-11H,2-9H2,1H3 |
| InChIKey | XCMGGGNTBFZKBQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-hexyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-hexyloxane?
The IUPAC name of 5-fluoro-2-hexyloxane (CID 154715253) is 5-fluoro-2-hexyloxane.
What is the SMILES notation for 5-fluoro-2-hexyloxane?
The canonical SMILES for 5-fluoro-2-hexyloxane is CCCCCCC1CCC(F)CO1.
What is the InChIKey of 5-fluoro-2-hexyloxane?
The InChIKey is XCMGGGNTBFZKBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21FO/c1-2-3-4-5-6-11-8-7-10(12)9-13-11/h10-11H,2-9H2,1H3.
What are the key properties of 5-fluoro-2-hexyloxane?
5-fluoro-2-hexyloxane has a molecular weight of 188.29 g/mol, XLogP of 3.47, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-hexyloxane is sourced from PubChem (CID 154715253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).