C4H6BrFO2S — CID 154715411
(3S,4R)-3-bromo-4-fluorothiolane 1,1-dioxide (PubChem CID 154715411) has the molecular formula C4H6BrFO2S and a molecular weight of 217.06 g/mol. Its IUPAC name is (3S,4R)-3-bromo-4-fluorothiolane 1,1-dioxide.
| Compound Name | (3S,4R)-3-bromo-4-fluorothiolane 1,1-dioxide |
|---|---|
| PubChem CID | 154715411 |
| Molecular Formula | C4H6BrFO2S |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 215.93 |
| IUPAC Name | (3S,4R)-3-bromo-4-fluorothiolane 1,1-dioxide |
| SMILES | O=S1(=O)C[C@@H](F)[C@H](Br)C1 |
| InChI | InChI=1S/C4H6BrFO2S/c5-3-1-9(7,8)2-4(3)6/h3-4H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | QKICCTJPCNQBQS-QWWZWVQMSA-N |
| XLogP | 0.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|