C4H6BrF5O2S2 — CID 134860507
[(3S,4S)-4-bromo-1,1-dioxothiolan-3-yl]-pentafluoro-λ6-sulfane (PubChem CID 134860507) has the molecular formula C4H6BrF5O2S2 and a molecular weight of 325.12 g/mol. Its IUPAC name is [(3S,4S)-4-bromo-1,1-dioxothiolan-3-yl]-pentafluoro-λ6-sulfane.
| Compound Name | [(3S,4S)-4-bromo-1,1-dioxothiolan-3-yl]-pentafluoro-λ6-sulfane |
|---|---|
| PubChem CID | 134860507 |
| Molecular Formula | C4H6BrF5O2S2 |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 323.89 |
| IUPAC Name | [(3S,4S)-4-bromo-1,1-dioxothiolan-3-yl]-pentafluoro-λ6-sulfane |
| SMILES | O=S1(=O)C[C@H](Br)[C@@H](S(F)(F)(F)(F)F)C1 |
| InChI | InChI=1S/C4H6BrF5O2S2/c5-3-1-13(11,12)2-4(3)14(6,7,8,9)10/h3-4H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | KNWDSCUZAFRZBW-IMJSIDKUSA-N |
| XLogP | 2.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|