C16H15F3O4 — CID 154715495
dimethyl (4R)-4-[3-(trifluoromethyl)phenyl]cyclopent-2-ene-1,1-dicarboxylate (PubChem CID 154715495) has the molecular formula C16H15F3O4 and a molecular weight of 328.29 g/mol. Its IUPAC name is dimethyl (4R)-4-[3-(trifluoromethyl)phenyl]cyclopent-2-ene-1,1-dicarboxylate.
| Compound Name | dimethyl (4R)-4-[3-(trifluoromethyl)phenyl]cyclopent-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 154715495 |
| Molecular Formula | C16H15F3O4 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | dimethyl (4R)-4-[3-(trifluoromethyl)phenyl]cyclopent-2-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C[C@H](c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H15F3O4/c1-22-13(20)15(14(21)23-2)7-6-11(9-15)10-4-3-5-12(8-10)16(17,18)19/h3-8,11H,9H2,1-2H3/t11-/m0/s1 |
| InChIKey | NHHJZJBSYMJDQC-NSHDSACASA-N |
| XLogP | 3.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|