C13H25FO — CID 154716013
(2R,6S)-2,6-dibutyl-4-fluorooxane (PubChem CID 154716013) has the molecular formula C13H25FO and a molecular weight of 216.34 g/mol. Its IUPAC name is (2R,6S)-2,6-dibutyl-4-fluorooxane.
| Compound Name | (2R,6S)-2,6-dibutyl-4-fluorooxane |
|---|---|
| PubChem CID | 154716013 |
| Molecular Formula | C13H25FO |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | (2R,6S)-2,6-dibutyl-4-fluorooxane |
| SMILES | CCCC[C@@H]1CC(F)C[C@H](CCCC)O1 |
| InChI | InChI=1S/C13H25FO/c1-3-5-7-12-9-11(14)10-13(15-12)8-6-4-2/h11-13H,3-10H2,1-2H3/t11?,12-,13+ |
| InChIKey | HXMZVGUJPYKCPK-YHWZYXNKSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |