C19H33NO4 — CID 154716121
tert-butyl (3aS,6aR)-4'-tert-butylspiro[3a,4,5,6a-tetrahydrodioxolo[3,4-b]pyrrole-3,1'-cyclohexane]-6-carboxylate (PubChem CID 154716121) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-4'-tert-butylspiro[3a,4,5,6a-tetrahydrodioxolo[3,4-b]pyrrole-3,1'-cyclohexane]-6-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-4'-tert-butylspiro[3a,4,5,6a-tetrahydrodioxolo[3,4-b]pyrrole-3,1'-cyclohexane]-6-carboxylate |
|---|---|
| PubChem CID | 154716121 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | tert-butyl (3aS,6aR)-4'-tert-butylspiro[3a,4,5,6a-tetrahydrodioxolo[3,4-b]pyrrole-3,1'-cyclohexane]-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@H]1OOC21CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H33NO4/c1-17(2,3)13-7-10-19(11-8-13)14-9-12-20(15(14)23-24-19)16(21)22-18(4,5)6/h13-15H,7-12H2,1-6H3/t13?,14-,15-,19?/m1/s1 |
| InChIKey | NUWSRYUKUYARSM-YYHKSVKZSA-N |
| XLogP | 4.51 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|