C19H35NO3 — CID 90957269
tert-butyl 3-(1-ethyl-4-methoxy-4-methylcyclohexyl)pyrrolidine-1-carboxylate (PubChem CID 90957269) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is tert-butyl 3-(1-ethyl-4-methoxy-4-methylcyclohexyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(1-ethyl-4-methoxy-4-methylcyclohexyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90957269 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | tert-butyl 3-(1-ethyl-4-methoxy-4-methylcyclohexyl)pyrrolidine-1-carboxylate |
| SMILES | CCC1(C2CCN(C(=O)OC(C)(C)C)C2)CCC(C)(OC)CC1 |
| InChI | InChI=1S/C19H35NO3/c1-7-19(11-9-18(5,22-6)10-12-19)15-8-13-20(14-15)16(21)23-17(2,3)4/h15H,7-14H2,1-6H3 |
| InChIKey | DYNQEVIHDKYBJC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |