C14H28OSi — CID 154716129
(Z,1R,2S)-1-cyclohexyl-2-trimethylsilylpent-3-en-1-ol (PubChem CID 154716129) has the molecular formula C14H28OSi and a molecular weight of 240.46 g/mol. Its IUPAC name is (Z,1R,2S)-1-cyclohexyl-2-trimethylsilylpent-3-en-1-ol.
| Compound Name | (Z,1R,2S)-1-cyclohexyl-2-trimethylsilylpent-3-en-1-ol |
|---|---|
| PubChem CID | 154716129 |
| Molecular Formula | C14H28OSi |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (Z,1R,2S)-1-cyclohexyl-2-trimethylsilylpent-3-en-1-ol |
| SMILES | C/C=C\[C@@H]([C@H](O)C1CCCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C14H28OSi/c1-5-9-13(16(2,3)4)14(15)12-10-7-6-8-11-12/h5,9,12-15H,6-8,10-11H2,1-4H3/b9-5-/t13-,14+/m0/s1 |
| InChIKey | LANXWSSOXHLXQB-VMZLMLEMSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|