C14H26OSi — CID 10586052
(1R)-1-cyclohexyl-2-trimethylsilylpenta-2,3-dien-1-ol (PubChem CID 10586052) has the molecular formula C14H26OSi and a molecular weight of 238.45 g/mol. Its IUPAC name is (1R)-1-cyclohexyl-2-trimethylsilylpenta-2,3-dien-1-ol.
| Compound Name | (1R)-1-cyclohexyl-2-trimethylsilylpenta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 10586052 |
| Molecular Formula | C14H26OSi |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (1R)-1-cyclohexyl-2-trimethylsilylpenta-2,3-dien-1-ol |
| SMILES | CC=C=C([C@H](O)C1CCCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C14H26OSi/c1-5-9-13(16(2,3)4)14(15)12-10-7-6-8-11-12/h5,12,14-15H,6-8,10-11H2,1-4H3/t9?,14-/m1/s1 |
| InChIKey | QYIWHPYAVBZDHR-IWSPRGBSSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|