C13H24OSi — CID 10846799
(1R)-1-cyclohexyl-2-trimethylsilylbuta-2,3-dien-1-ol (PubChem CID 10846799) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is (1R)-1-cyclohexyl-2-trimethylsilylbuta-2,3-dien-1-ol.
| Compound Name | (1R)-1-cyclohexyl-2-trimethylsilylbuta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 10846799 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (1R)-1-cyclohexyl-2-trimethylsilylbuta-2,3-dien-1-ol |
| SMILES | C=C=C([C@H](O)C1CCCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C13H24OSi/c1-5-12(15(2,3)4)13(14)11-9-7-6-8-10-11/h11,13-14H,1,6-10H2,2-4H3/t13-/m1/s1 |
| InChIKey | ATSZCLXAVZIZRW-CYBMUJFWSA-N |
| XLogP | 3.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|