C19H36OSi — CID 101261971
1-cyclohexyl-2-tri(propan-2-yl)silylbuta-2,3-dien-1-ol (PubChem CID 101261971) has the molecular formula C19H36OSi and a molecular weight of 308.58 g/mol. Its IUPAC name is 1-cyclohexyl-2-tri(propan-2-yl)silylbuta-2,3-dien-1-ol.
| Compound Name | 1-cyclohexyl-2-tri(propan-2-yl)silylbuta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 101261971 |
| Molecular Formula | C19H36OSi |
| Molecular Weight | 308.58 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 1-cyclohexyl-2-tri(propan-2-yl)silylbuta-2,3-dien-1-ol |
| SMILES | C=C=C(C(O)C1CCCCC1)[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H36OSi/c1-8-18(19(20)17-12-10-9-11-13-17)21(14(2)3,15(4)5)16(6)7/h14-17,19-20H,1,9-13H2,2-7H3 |
| InChIKey | UHSVAKXKPHIZGF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|