C33H68OSn2 — CID 10055651
1-cyclohexyl-3,3-bis(tributylstannyl)prop-2-en-1-ol (PubChem CID 10055651) has the molecular formula C33H68OSn2 and a molecular weight of 718.33 g/mol. Its IUPAC name is 1-cyclohexyl-3,3-bis(tributylstannyl)prop-2-en-1-ol.
| Compound Name | 1-cyclohexyl-3,3-bis(tributylstannyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 10055651 |
| Molecular Formula | C33H68OSn2 |
| Molecular Weight | 718.33 g/mol |
| Exact Mass | 720.33 |
| IUPAC Name | 1-cyclohexyl-3,3-bis(tributylstannyl)prop-2-en-1-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(=CC(O)C1CCCCC1)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C9H14O.6C4H9.2Sn/c1-2-9(10)8-6-4-3-5-7-8;6*1-3-4-2;;/h2,8-10H,3-7H2;6*1,3-4H2,2H3;; |
| InChIKey | DJPLIJOSUDGPTR-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.33 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |