C16H16FN5O3 — CID 154716723
5-(6-amino-2-fluoro-8-phenylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 154716723) has the molecular formula C16H16FN5O3 and a molecular weight of 345.33 g/mol. Its IUPAC name is 5-(6-amino-2-fluoro-8-phenylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | 5-(6-amino-2-fluoro-8-phenylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 154716723 |
| Molecular Formula | C16H16FN5O3 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 5-(6-amino-2-fluoro-8-phenylpurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1nc(F)nc2c1nc(-c1ccccc1)n2C1CC(O)C(CO)O1 |
| InChI | InChI=1S/C16H16FN5O3/c17-16-20-13(18)12-15(21-16)22(11-6-9(24)10(7-23)25-11)14(19-12)8-4-2-1-3-5-8/h1-5,9-11,23-24H,6-7H2,(H2,18,20,21) |
| InChIKey | ZTJUWIZGZBWNEN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |