C16H29FO — CID 154716801
(1R,4aS,8aS)-6-fluoro-1-heptyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene (PubChem CID 154716801) has the molecular formula C16H29FO and a molecular weight of 256.40 g/mol. Its IUPAC name is (1R,4aS,8aS)-6-fluoro-1-heptyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene.
| Compound Name | (1R,4aS,8aS)-6-fluoro-1-heptyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene |
|---|---|
| PubChem CID | 154716801 |
| Molecular Formula | C16H29FO |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | (1R,4aS,8aS)-6-fluoro-1-heptyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene |
| SMILES | CCCCCCC[C@H]1OCC[C@H]2CC(F)CC[C@@H]21 |
| InChI | InChI=1S/C16H29FO/c1-2-3-4-5-6-7-16-15-9-8-14(17)12-13(15)10-11-18-16/h13-16H,2-12H2,1H3/t13-,14?,15-,16+/m0/s1 |
| InChIKey | KEFBCQFXLJBQPJ-HNSVSWJLSA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|