C21H23NO2 — CID 154717754
2-methylpropyl (2R)-2-(4-methylanilino)-4-phenylbut-3-ynoate (PubChem CID 154717754) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-methylpropyl (2R)-2-(4-methylanilino)-4-phenylbut-3-ynoate.
| Compound Name | 2-methylpropyl (2R)-2-(4-methylanilino)-4-phenylbut-3-ynoate |
|---|---|
| PubChem CID | 154717754 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-methylpropyl (2R)-2-(4-methylanilino)-4-phenylbut-3-ynoate |
| SMILES | Cc1ccc(N[C@H](C#Cc2ccccc2)C(=O)OCC(C)C)cc1 |
| InChI | InChI=1S/C21H23NO2/c1-16(2)15-24-21(23)20(14-11-18-7-5-4-6-8-18)22-19-12-9-17(3)10-13-19/h4-10,12-13,16,20,22H,15H2,1-3H3/t20-/m1/s1 |
| InChIKey | VYRQAXZDMJVCHX-HXUWFJFHSA-N |
| XLogP | 4.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|