C15H30O2Si — CID 154718743
(5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloct-7-en-2-one (PubChem CID 154718743) has the molecular formula C15H30O2Si and a molecular weight of 270.49 g/mol. Its IUPAC name is (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloct-7-en-2-one.
| Compound Name | (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloct-7-en-2-one |
|---|---|
| PubChem CID | 154718743 |
| Molecular Formula | C15H30O2Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloct-7-en-2-one |
| SMILES | C=C[C@H](C)[C@H](CCC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O2Si/c1-9-12(2)14(11-10-13(3)16)17-18(7,8)15(4,5)6/h9,12,14H,1,10-11H2,2-8H3/t12-,14-/m0/s1 |
| InChIKey | LKQUPHFQZQRSDZ-JSGCOSHPSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|