C13H26O2Si — CID 57136616
2-propyl-4-trimethylsilyloxyhept-6-enal (PubChem CID 57136616) has the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. Its IUPAC name is 2-propyl-4-trimethylsilyloxyhept-6-enal.
| Compound Name | 2-propyl-4-trimethylsilyloxyhept-6-enal |
|---|---|
| PubChem CID | 57136616 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2-propyl-4-trimethylsilyloxyhept-6-enal |
| SMILES | C=CCC(CC(C=O)CCC)O[Si](C)(C)C |
| InChI | InChI=1S/C13H26O2Si/c1-6-8-12(11-14)10-13(9-7-2)15-16(3,4)5/h7,11-13H,2,6,8-10H2,1,3-5H3 |
| InChIKey | DZHMRRQWTAHZEZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|