C26H24N2O3S — CID 154718765
4-methyl-N-[2-[(E)-naphthalen-2-ylmethylideneamino]oxy-2-phenylethyl]benzenesulfonamide (PubChem CID 154718765) has the molecular formula C26H24N2O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is 4-methyl-N-[2-[(E)-naphthalen-2-ylmethylideneamino]oxy-2-phenylethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[(E)-naphthalen-2-ylmethylideneamino]oxy-2-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 154718765 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 4-methyl-N-[2-[(E)-naphthalen-2-ylmethylideneamino]oxy-2-phenylethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(O/N=C/c2ccc3ccccc3c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N2O3S/c1-20-11-15-25(16-12-20)32(29,30)28-19-26(23-8-3-2-4-9-23)31-27-18-21-13-14-22-7-5-6-10-24(22)17-21/h2-18,26,28H,19H2,1H3/b27-18+ |
| InChIKey | FIOYSZQVKMYOCY-OVVQPSECSA-N |
| XLogP | 5.22 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|