C22H21FN2O3S — CID 154718760
N-[2-[(E)-(4-fluorophenyl)methylideneamino]oxy-2-phenylethyl]-4-methylbenzenesulfonamide (PubChem CID 154718760) has the molecular formula C22H21FN2O3S and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[2-[(E)-(4-fluorophenyl)methylideneamino]oxy-2-phenylethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[(E)-(4-fluorophenyl)methylideneamino]oxy-2-phenylethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 154718760 |
| Molecular Formula | C22H21FN2O3S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[2-[(E)-(4-fluorophenyl)methylideneamino]oxy-2-phenylethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(O/N=C/c2ccc(F)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21FN2O3S/c1-17-7-13-21(14-8-17)29(26,27)25-16-22(19-5-3-2-4-6-19)28-24-15-18-9-11-20(23)12-10-18/h2-15,22,25H,16H2,1H3/b24-15+ |
| InChIKey | QMGYEZHAJFMTEM-BUVRLJJBSA-N |
| XLogP | 4.20 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|