C18H22FNO3S — CID 90623072
N-[2-(3-fluorophenyl)-2-methoxyethyl]-4-propylbenzenesulfonamide (PubChem CID 90623072) has the molecular formula C18H22FNO3S and a molecular weight of 351.44 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-2-methoxyethyl]-4-propylbenzenesulfonamide.
| Compound Name | N-[2-(3-fluorophenyl)-2-methoxyethyl]-4-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 90623072 |
| Molecular Formula | C18H22FNO3S |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[2-(3-fluorophenyl)-2-methoxyethyl]-4-propylbenzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)NCC(OC)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C18H22FNO3S/c1-3-5-14-8-10-17(11-9-14)24(21,22)20-13-18(23-2)15-6-4-7-16(19)12-15/h4,6-12,18,20H,3,5,13H2,1-2H3 |
| InChIKey | PWVOUEJZKBRXOZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |