C15H14Cl2FNO3S — CID 90623112
2,5-dichloro-N-[2-(3-fluorophenyl)-2-methoxyethyl]benzenesulfonamide (PubChem CID 90623112) has the molecular formula C15H14Cl2FNO3S and a molecular weight of 378.25 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(3-fluorophenyl)-2-methoxyethyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[2-(3-fluorophenyl)-2-methoxyethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90623112 |
| Molecular Formula | C15H14Cl2FNO3S |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 2,5-dichloro-N-[2-(3-fluorophenyl)-2-methoxyethyl]benzenesulfonamide |
| SMILES | COC(CNS(=O)(=O)c1cc(Cl)ccc1Cl)c1cccc(F)c1 |
| InChI | InChI=1S/C15H14Cl2FNO3S/c1-22-14(10-3-2-4-12(18)7-10)9-19-23(20,21)15-8-11(16)5-6-13(15)17/h2-8,14,19H,9H2,1H3 |
| InChIKey | HHQZZKVHKULNRS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |