C16H17Cl2NO5S — CID 166396048
3,5-dichloro-2-hydroxy-N-[2-methoxy-2-(4-methoxyphenyl)ethyl]benzenesulfonamide (PubChem CID 166396048) has the molecular formula C16H17Cl2NO5S and a molecular weight of 406.29 g/mol. Its IUPAC name is 3,5-dichloro-2-hydroxy-N-[2-methoxy-2-(4-methoxyphenyl)ethyl]benzenesulfonamide.
| Compound Name | 3,5-dichloro-2-hydroxy-N-[2-methoxy-2-(4-methoxyphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166396048 |
| Molecular Formula | C16H17Cl2NO5S |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 3,5-dichloro-2-hydroxy-N-[2-methoxy-2-(4-methoxyphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(C(CNS(=O)(=O)c2cc(Cl)cc(Cl)c2O)OC)cc1 |
| InChI | InChI=1S/C16H17Cl2NO5S/c1-23-12-5-3-10(4-6-12)14(24-2)9-19-25(21,22)15-8-11(17)7-13(18)16(15)20/h3-8,14,19-20H,9H2,1-2H3 |
| InChIKey | MBXFGDIZBYHARW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|