C15H14Cl2N2O5S — CID 100763252
2,3-dichloro-N-[(2R)-2-methoxy-2-phenylethyl]-5-nitrobenzenesulfonamide (PubChem CID 100763252) has the molecular formula C15H14Cl2N2O5S and a molecular weight of 405.26 g/mol. Its IUPAC name is 2,3-dichloro-N-[(2R)-2-methoxy-2-phenylethyl]-5-nitrobenzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[(2R)-2-methoxy-2-phenylethyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 100763252 |
| Molecular Formula | C15H14Cl2N2O5S |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | 2,3-dichloro-N-[(2R)-2-methoxy-2-phenylethyl]-5-nitrobenzenesulfonamide |
| SMILES | CO[C@@H](CNS(=O)(=O)c1cc([N+](=O)[O-])cc(Cl)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H14Cl2N2O5S/c1-24-13(10-5-3-2-4-6-10)9-18-25(22,23)14-8-11(19(20)21)7-12(16)15(14)17/h2-8,13,18H,9H2,1H3/t13-/m0/s1 |
| InChIKey | MQZPRWDQPBXLIA-ZDUSSCGKSA-N |
| XLogP | 3.57 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|