C14H16N2O5S2 — CID 90584070
N-(2-methoxy-2-thiophen-3-ylethyl)-2-methyl-5-nitrobenzenesulfonamide (PubChem CID 90584070) has the molecular formula C14H16N2O5S2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-(2-methoxy-2-thiophen-3-ylethyl)-2-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(2-methoxy-2-thiophen-3-ylethyl)-2-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 90584070 |
| Molecular Formula | C14H16N2O5S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | N-(2-methoxy-2-thiophen-3-ylethyl)-2-methyl-5-nitrobenzenesulfonamide |
| SMILES | COC(CNS(=O)(=O)c1cc([N+](=O)[O-])ccc1C)c1ccsc1 |
| InChI | InChI=1S/C14H16N2O5S2/c1-10-3-4-12(16(17)18)7-14(10)23(19,20)15-8-13(21-2)11-5-6-22-9-11/h3-7,9,13,15H,8H2,1-2H3 |
| InChIKey | VBGFPFXJEGYIAH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|