C17H23NO3S2 — CID 90584060
4-tert-butyl-N-(2-methoxy-2-thiophen-3-ylethyl)benzenesulfonamide (PubChem CID 90584060) has the molecular formula C17H23NO3S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-methoxy-2-thiophen-3-ylethyl)benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-(2-methoxy-2-thiophen-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90584060 |
| Molecular Formula | C17H23NO3S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-tert-butyl-N-(2-methoxy-2-thiophen-3-ylethyl)benzenesulfonamide |
| SMILES | COC(CNS(=O)(=O)c1ccc(C(C)(C)C)cc1)c1ccsc1 |
| InChI | InChI=1S/C17H23NO3S2/c1-17(2,3)14-5-7-15(8-6-14)23(19,20)18-11-16(21-4)13-9-10-22-12-13/h5-10,12,16,18H,11H2,1-4H3 |
| InChIKey | XTUOSNLJOZKZNE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |