C15H17NO5S2 — CID 71804782
methyl 4-[(2-methoxy-2-thiophen-3-ylethyl)sulfamoyl]benzoate (PubChem CID 71804782) has the molecular formula C15H17NO5S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is methyl 4-[(2-methoxy-2-thiophen-3-ylethyl)sulfamoyl]benzoate.
| Compound Name | methyl 4-[(2-methoxy-2-thiophen-3-ylethyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 71804782 |
| Molecular Formula | C15H17NO5S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | methyl 4-[(2-methoxy-2-thiophen-3-ylethyl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCC(OC)c2ccsc2)cc1 |
| InChI | InChI=1S/C15H17NO5S2/c1-20-14(12-7-8-22-10-12)9-16-23(18,19)13-5-3-11(4-6-13)15(17)21-2/h3-8,10,14,16H,9H2,1-2H3 |
| InChIKey | DBKNXRUDISNLCA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |