C13H14BrNO3S2 — CID 97427133
2-bromo-N-[(2S)-2-methoxy-2-thiophen-3-ylethyl]benzenesulfonamide (PubChem CID 97427133) has the molecular formula C13H14BrNO3S2 and a molecular weight of 376.30 g/mol. Its IUPAC name is 2-bromo-N-[(2S)-2-methoxy-2-thiophen-3-ylethyl]benzenesulfonamide.
| Compound Name | 2-bromo-N-[(2S)-2-methoxy-2-thiophen-3-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 97427133 |
| Molecular Formula | C13H14BrNO3S2 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 2-bromo-N-[(2S)-2-methoxy-2-thiophen-3-ylethyl]benzenesulfonamide |
| SMILES | CO[C@H](CNS(=O)(=O)c1ccccc1Br)c1ccsc1 |
| InChI | InChI=1S/C13H14BrNO3S2/c1-18-12(10-6-7-19-9-10)8-15-20(16,17)13-5-3-2-4-11(13)14/h2-7,9,12,15H,8H2,1H3/t12-/m1/s1 |
| InChIKey | FTTSFQYMTDLAOK-GFCCVEGCSA-N |
| XLogP | 3.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |