C13H14ClNO3S2 — CID 90584031
3-chloro-N-(2-methoxy-2-thiophen-3-ylethyl)benzenesulfonamide (PubChem CID 90584031) has the molecular formula C13H14ClNO3S2 and a molecular weight of 331.85 g/mol. Its IUPAC name is 3-chloro-N-(2-methoxy-2-thiophen-3-ylethyl)benzenesulfonamide.
| Compound Name | 3-chloro-N-(2-methoxy-2-thiophen-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90584031 |
| Molecular Formula | C13H14ClNO3S2 |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 3-chloro-N-(2-methoxy-2-thiophen-3-ylethyl)benzenesulfonamide |
| SMILES | COC(CNS(=O)(=O)c1cccc(Cl)c1)c1ccsc1 |
| InChI | InChI=1S/C13H14ClNO3S2/c1-18-13(10-5-6-19-9-10)8-15-20(16,17)12-4-2-3-11(14)7-12/h2-7,9,13,15H,8H2,1H3 |
| InChIKey | MITIUTASVBIGLL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |