About N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide
N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide (PubChem CID 154718801) has the molecular formula C20H19NO2
and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide.
Molecular Properties
| Compound Name | N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide |
| PubChem CID | 154718801 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)c1ccccc1C#Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H19NO2/c1-15(2)20(22)21(3)19-8-6-5-7-17(19)12-9-16-10-13-18(23-4)14-11-16/h5-8,10-11,13-14H,1H2,2-4H3 |
| InChIKey | QCEWEMDDUHHQQL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide?
The IUPAC name of N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide (CID 154718801) is N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide.
What is the SMILES notation for N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide?
The canonical SMILES for N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide is C=C(C)C(=O)N(C)c1ccccc1C#Cc1ccc(OC)cc1.
What is the InChIKey of N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide?
The InChIKey is QCEWEMDDUHHQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO2/c1-15(2)20(22)21(3)19-8-6-5-7-17(19)12-9-16-10-13-18(23-4)14-11-16/h5-8,10-11,13-14H,1H2,2-4H3.
What are the key properties of N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide?
N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide has a molecular weight of 305.38 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2-(4-methoxyphenyl)ethynyl]phenyl]-N,2-dimethylprop-2-enamide is sourced from PubChem (CID 154718801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).