C10H14O3S — CID 154718949
[(3aS,4R,6aR)-4-ethynyl-2,2-dimethyl-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-4-yl]methanol (PubChem CID 154718949) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is [(3aS,4R,6aR)-4-ethynyl-2,2-dimethyl-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-4-yl]methanol.
| Compound Name | [(3aS,4R,6aR)-4-ethynyl-2,2-dimethyl-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-4-yl]methanol |
|---|---|
| PubChem CID | 154718949 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | [(3aS,4R,6aR)-4-ethynyl-2,2-dimethyl-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-4-yl]methanol |
| SMILES | C#C[C@]1(CO)SC[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C10H14O3S/c1-4-10(6-11)8-7(5-14-10)12-9(2,3)13-8/h1,7-8,11H,5-6H2,2-3H3/t7-,8-,10+/m0/s1 |
| InChIKey | DPZRIGDHJZHEOQ-OYNCUSHFSA-N |
| XLogP | 0.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|