C8H14O3S — CID 45358189
(2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)methanol (PubChem CID 45358189) has the molecular formula C8H14O3S and a molecular weight of 190.26 g/mol. Its IUPAC name is (2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)methanol.
| Compound Name | (2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)methanol |
|---|---|
| PubChem CID | 45358189 |
| Molecular Formula | C8H14O3S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | (2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxol-4-yl)methanol |
| SMILES | CC1(C)OC2CSC(CO)C2O1 |
| InChI | InChI=1S/C8H14O3S/c1-8(2)10-5-4-12-6(3-9)7(5)11-8/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | YCABSTBYVZTCQI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |