C13H27BO3 — CID 154719660
(2R)-3-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-ol (PubChem CID 154719660) has the molecular formula C13H27BO3 and a molecular weight of 242.17 g/mol. Its IUPAC name is (2R)-3-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-ol.
| Compound Name | (2R)-3-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-ol |
|---|---|
| PubChem CID | 154719660 |
| Molecular Formula | C13H27BO3 |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | (2R)-3-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-ol |
| SMILES | CCC(CC)[C@@](C)(O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H27BO3/c1-8-10(9-2)13(7,15)14-16-11(3,4)12(5,6)17-14/h10,15H,8-9H2,1-7H3/t13-/m1/s1 |
| InChIKey | URELVJZWINJWAR-CYBMUJFWSA-N |
| XLogP | 2.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|