C15H30BO3+ — CID 90995355
2,3,4-trimethyl-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pentan-2-ol (PubChem CID 90995355) has the molecular formula C15H30BO3+ and a molecular weight of 269.21 g/mol. Its IUPAC name is 2,3,4-trimethyl-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pentan-2-ol.
| Compound Name | 2,3,4-trimethyl-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pentan-2-ol |
|---|---|
| PubChem CID | 90995355 |
| Molecular Formula | C15H30BO3+ |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.23 |
| IUPAC Name | 2,3,4-trimethyl-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pentan-2-ol |
| SMILES | CC(C)C(C)([CH+]B1OC(C)(C)C(C)(C)O1)C(C)(C)O |
| InChI | InChI=1S/C15H30BO3/c1-11(2)15(9,12(3,4)17)10-16-18-13(5,6)14(7,8)19-16/h10-11,17H,1-9H3/q+1 |
| InChIKey | AAPUSHLLRDQAPL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|