C13H26BO3+ — CID 91564046
2,3,3-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-ol (PubChem CID 91564046) has the molecular formula C13H26BO3+ and a molecular weight of 241.16 g/mol. Its IUPAC name is 2,3,3-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-ol.
| Compound Name | 2,3,3-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 91564046 |
| Molecular Formula | C13H26BO3+ |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 2,3,3-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-ol |
| SMILES | CC(C)(O)C(C)(C)[CH+]B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H26BO3/c1-10(2,11(3,4)15)9-14-16-12(5,6)13(7,8)17-14/h9,15H,1-8H3/q+1 |
| InChIKey | FAPDYCLBVUMAEU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|