C14H31BO3 — CID 143895307
2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane;2,3,3-trimethylbutan-2-ol (PubChem CID 143895307) has the molecular formula C14H31BO3 and a molecular weight of 258.21 g/mol. Its IUPAC name is 2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane;2,3,3-trimethylbutan-2-ol.
| Compound Name | 2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane;2,3,3-trimethylbutan-2-ol |
|---|---|
| PubChem CID | 143895307 |
| Molecular Formula | C14H31BO3 |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | 2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane;2,3,3-trimethylbutan-2-ol |
| SMILES | CB1OC(C)(C)C(C)(C)O1.CC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C7H15BO2.C7H16O/c1-6(2)7(3,4)10-8(5)9-6;1-6(2,3)7(4,5)8/h1-5H3;8H,1-5H3 |
| InChIKey | QPJNGVSCKIAXBK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|