C20H21NO2S — CID 154719683
N-[(1E,4E)-1,5-bis(3-methylphenyl)penta-1,4-dien-3-ylidene]methanesulfonamide (PubChem CID 154719683) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[(1E,4E)-1,5-bis(3-methylphenyl)penta-1,4-dien-3-ylidene]methanesulfonamide.
| Compound Name | N-[(1E,4E)-1,5-bis(3-methylphenyl)penta-1,4-dien-3-ylidene]methanesulfonamide |
|---|---|
| PubChem CID | 154719683 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[(1E,4E)-1,5-bis(3-methylphenyl)penta-1,4-dien-3-ylidene]methanesulfonamide |
| SMILES | Cc1cccc(/C=C/C(/C=C/c2cccc(C)c2)=NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H21NO2S/c1-16-6-4-8-18(14-16)10-12-20(21-24(3,22)23)13-11-19-9-5-7-17(2)15-19/h4-15H,1-3H3/b12-10+,13-11+ |
| InChIKey | RNEYNLQIQMYFPU-DCIPZJNNSA-N |
| XLogP | 4.43 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|